Product Overview
Xanthatin | T3S0153 | TargetMol Chemicals
CAS: 26791-73-1
Smiles: C[C@H]1C[C@@H]2OC(=O)C(=C)[C@H]2CC=C1\C=C\C(C)=O
Formula: C15H18O3
Pathway: Angiogenesis|||Apoptosis|||Cytoskeletal Signaling|||Metabolism|||Microbiology/Virology|||Stem Cells|||Tyrosine Kinase/Adaptors
Target: Apoptosis|||VEGFR|||Lipoxygenase|||Wnt/beta-catenin|||Antibacterial
Receptor: N/A
Bioactivity: 1. Xanthatin has cytotoxic activity. 2. Xanthatin has antibacterial and antifungal activies against MRSA. 3. Xanthatin may have therapeutic potential against NSCLC. 4. Xanthatin can inhibit murine melanoma B16-F1 cell proliferation possibly associated with activation of Wnt/β-catenin pathway and its activity against melanoma tumor might also be relevant to inhibition of angiogenesis.
Molecular Weight: 246, 306
