Product Overview
yangonin | T3S0738 | TargetMol Chemicals
CAS: 500-62-9
Smiles: COc1ccc(\C=C\c2cc(OC)cc(=O)o2)cc1
Formula: C15H14O4
Pathway: Autophagy|||GPCR/G Protein|||NF-Κb
Target: Cannabinoid Receptor|||NF-κB|||Autophagy
Receptor: N/A
Bioactivity: 1. Yangonin is a novel CB receptor ligand, it exhibits affinity for the human recombinant CB receptor. 2. Yangonin could be a valuable candidate for the intervention of NF-κB-dependent pathological conditions such as inflammation.
Molecular Weight: 258, 273
