Product Overview
Zeaxanthin | TMS2180 | TargetMol Chemicals
CAS: 144-68-3
Smiles: CC(\C=C\C=C(C)\C=C\C1=C(C)C[C@@H](O)CC1(C)C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)C[C@@H](O)CC1(C)C
Formula: C40H56O2
Pathway: Metabolism|||oxidation-reduction
Target: Antioxidant|||Endogenous Metabolite
Receptor: N/A
Bioactivity: 1. Lutein and Zeaxanthin in neural tissue may have biological effects that include antioxidation, anti-inflammation, and structural actions. 2. Lutein and Zeaxanthin may be protective against eye disease because they absorb damaging blue light that enters the eye.
Molecular Weight: 568, 88
