Product Overview
2, 2, 14, 14-Tetramethyl-8-oxopentadecanedioic acid | T40514 | TargetMol Chemicals
CAS: 413624-71-2
Smiles: CC(C)(CCCCCC(CCCCCC(C)(C)C(O)=O)=O)C(O)=O
Formula: C19H34O5
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: 2, 2, 14, 14-Tetramethyl-8-oxopentadecanedioic acid is a ketone compound extracted from patent WO2002030860A2, compound example II-9. 2, 2, 14, 14-Tetramethyl-8-oxopentadecanedioic acid can be used for the research of cardiovascular diseases, dyslipidemias, dysproteinemias, and glucose metabolism disorders [1] .
Molecular Weight: 342, 47
