Product Overview
2, 2, 5, 7, 8-Pentamethyl-6-Chromanol | T14008 | TargetMol Chemicals
CAS: 950-99-2
Smiles: Cc1c(C)c2OC(C)(C)CCc2c(C)c1O
Formula: C14H20O2
Pathway: Endocrinology/Hormones
Target: Androgen Receptor
Receptor: N/A
Bioactivity: 2, 2, 5, 7, 8-Pentamethyl-6-Chromanol is the anti-oxidant moiety of vitamin E (α-tocopherol), which has potent androgen receptor (AR) signaling modulation and anti-cancer activity against prostate cancer cell lines.
Molecular Weight: 220, 312
