Product Overview
25-Hydroxycholesterol | T4717 | TargetMol Chemicals
CAS: 2140-46-7
Smiles: C[C@H](CCCC(C)(C)O)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C
Formula: C27H46O2
Pathway: Metabolism|||Others
Target: Others|||Endogenous Metabolite|||HMG-CoA Reductase
Receptor: N/A
Bioactivity: 25-Hydroxycholesterol is a steroid derivative that suppresses the cleavage of sterol regulatory element binding proteins (SREBPs). It inhibits HMG-CoA reductase and so it also plays a significant role in the in vivo regulation of cholesterol biosynthesis after an acute dietary cholesterol challenge. 25-hydroxycholesterol is a potent (EC50≈65 nM) and selective suppressor of IgA production by B cells.
Molecular Weight: 402, 663
