3, 4-Secocucurbita-4, 24-diene-3, 26, 29-trioic acid | TN2887

3, 4-Secocucurbita-4, 24-diene-3, 26, 29-trioic acid | TN2887 | TargetMol Chemicals

CAS: 329975-47-5

Smiles: C[C@H](CC\C=C(/C)C(O)=O)[C@H]1CC[C@@]2(C)[C@@H]3CCC([C@@H](CCC(O)=O)[C@]3(C)CC[C@]12C)=C(C)C(O)=O

Formula: C30H46O6

Pathway: Metabolism

Target: Phosphatase

Receptor: N/A

Bioactivity: (24E)-3, 4-Seco-cucurbita-4, 24-diene-3, 26, 29-trioic acid can inhibit the activity of protein tyrosine phosphatase 1B (PTP1B), with IC 50 values of 0.4uM.

Molecular Weight: 502, 7