Product Overview
6-Bnz-cAMP sodium salt | T22529 | TargetMol Chemicals
CAS: 1135306-29-4
Smiles: [H][C@@]12COP(=O)(O[Na])O[C@@]1([H])[C@@H](O)[C@@H](O2)n1cnc2c(NC(=O)c3ccccc3)ncnc12
Formula: C17H15N5NaO7P
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: 6-Bnz-cAMP is a PKA-selective activator. It regulates the PKA dependent signaling pathways. The proliferative signaling pathway which activated by the 6-Bnz-cAMP involves activation of the epidermal growth factor receptor and ERK1/2. Extending the duration of PKA-dependent ERK1/2 activation and converted cAMP from a proliferative into an anti-proliferative, neurite outgrowth- promoting signal.
Molecular Weight: 455, 299
