Product Overview
Alisol B 23-acetate | T6S2246 | TargetMol Chemicals
CAS: 26575-95-1
Smiles: C[C@H](C[C@H](OC(C)=O)[C@H]1OC1(C)C)C1=C2C[C@H](O)[C@H]3[C@@]4(C)CCC(=O)C(C)(C)[C@@H]4CC[C@]3(C)[C@@]2(C)CC1
Formula: C32H50O5
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: 1. Alisol B 23-acetate produces protective effect against ANIT-induced hepatotoxity and cholestasis, due to FXR-mediated regulation of transporters and enzymes. 2. Alisol B 23-acetate produces promotive effect on liver regeneration, due to FXR-mediated regulation of genes involved in hepatocyte proliferation and hepato-protection. 3. Alisol B 23-acetate produces a protective effect against CCl4-induced hepatotoxicity, due to FXR and STAT3-mediated gene regulation.
Molecular Weight: 514, 747
