Product Overview
Alisol B acetate | TN6394 | TargetMol Chemicals
CAS: 19865-76-0
Smiles: CC(C)C(=O)[C@H](C[C@@H](C)C1=C2C[C@H](O)[C@H]3[C@@]4(C)CCC(=O)C(C)(C)[C@@H]4CC[C@]3(C)[C@@]2(C)CC1)OC(C)=O
Formula: C32H50O5
Pathway: N/A
Target: N/A
Receptor: N/A
Bioactivity: Alisol B acetate can induce Bax nuclear translocation and apoptosis in human hormone-resistant prostate cancer PC-3 cells, the Bax activation and translocation from the cytosol to nucleus might be a crucial response to the apoptotic effect. Alisol B acetate exhibits an antiproliferative effect in SGC7901 cells by inducing apoptosis, apoptosis of SGC7901 cells involves mitochondria-caspase and PI3K/Akt dependent pathways.
Molecular Weight: N/A
