Product Overview
Alogliptin Benzoate | T2401 | TargetMol Chemicals
CAS: 850649-62-6
Smiles: OC(=O)c1ccccc1.Cn1c(=O)cc(N2CCC[C@@H](N)C2)n(Cc2ccccc2C#N)c1=O
Formula: C25H27N5O4
Pathway: Apoptosis|||Cell Cycle/Checkpoint|||Proteases/Proteasome|||Ubiquitination
Target: Ferroptosis|||Proteasome|||DPP-4
Receptor: N/A
Bioactivity: Alogliptin Benzoate(SYR 322), an effective and specific DPP-4 inhibitor (IC50<10 nM), exhibits greater than 10, 000-fold selectivity over DPP-8/9. Alogliptin may inhibit inflammatory responses by preventing the toll-like receptor 4 (TLR-4)-mediated formation of proinflammatory cytokines.
Molecular Weight: 461, 522
