Product Overview
Bedaquiline | T2585 | TargetMol Chemicals
CAS: 843663-66-1
Smiles: COc1nc2ccc(Br)cc2cc1[C@@H](c1ccccc1)[C@@](O)(CCN(C)C)c1cccc2ccccc12
Formula: C32H31BrN2O2
Pathway: Microbiology/Virology
Target: Antibacterial|||Antibiotic
Receptor: N/A
Bioactivity: Bedaquiline(TMC207; R207910) is an anti-tuberculosis drug which selectively inhibit the mycobacterial energy metabolism i.e. ATP synthesis and found to be effective against all states of Mycobacterium tuberculosis.
Molecular Weight: 555, 516
