Product Overview
Berberine chloride hydrate | T14545 | TargetMol Chemicals
CAS: 68030-18-2
Smiles: COC1=C(OC)C2=C[N+]3=C(C(C(CC3)=C4)=CC5=C4OCO5)C=C2C=C1.[Cl-].O
Formula: C20H20ClNO5
Pathway: Immunology/Inflammation
Target: ROS
Receptor: N/A
Bioactivity: Berberine chloride hydrate (Natural Yellow 18 chloride hydrate) is an alkaloid isolated from the Chinese herbal medicine Huanglian, as an antibiotic. It induces reactive oxygen species (ROS) generation and inhibits DNA topoisomerase. Antineoplastic properties[1].
Molecular Weight: 389, 83
