Product Overview
Bisphenol A | T5623 | TargetMol Chemicals
CAS: 80-05-7
Smiles: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1
Formula: C15H16O2
Pathway: Metabolism|||Others
Target: Others|||Endogenous Metabolite
Receptor: N/A
Bioactivity: Bisphenol A is a starting material for the synthesis of plastics, primarily certain polycarbonates and epoxy resins, as well as some polysulfones and certain niche materials. It exhibits estrogen-mimicking, hormone-like properties.
Molecular Weight: 228, 291
