Product Overview
Boc-C1-PEG3-C4-OBn | T17646 | TargetMol Chemicals
CAS: 2381196-81-0
Smiles: CC(C)(C)OC(=O)COCCOCCOCCCCCCOCc1ccccc1
Formula: C23H38O6
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: Boc-C1-PEG3-C4-OBn (PROTAC Linker 15) is a PROTAC linker, which refers to the PEG composition. Boc-C1-PEG3-C4-OBn can be used in the synthesis of a series of PROTACs, such as PROTAC SGK3 degrader-1. PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1].
Molecular Weight: 410, 551
