Product Overview
Boc-C1-PEG3-C4-OH | T17647 | TargetMol Chemicals
CAS: 2376724-97-7
Smiles: CC(C)(C)OC(=O)COCCOCCOCCCCCCO
Formula: C16H32O6
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: Boc-C1-PEG3-C4-OH is a PROTAC linker, which refers to the Alkyl/ether composition. Boc-C1-PEG3-C4-OH can be used in the synthesis of a series of PROTACs. PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1].
Molecular Weight: 320, 426
