Product Overview
Cetirizine Impurity B dihydrochloride | T9084 | TargetMol Chemicals
CAS: 1000690-91-4
Smiles: O=C(O)CN1CCN(C(C2=CC=C(Cl)C=C2)C3=CC=CC=C3)CC1.[H]Cl.[H]Cl
Formula: C19H23Cl3N2O2
Pathway: GPCR/G Protein|||Immunology/Inflammation|||Neuroscience
Target: Histamine Receptor
Receptor: N/A
Bioactivity: Cetirizine Impurity B dihydrochloride is an impurity of Cetirizine dihydrochloride. Cetirizine, a second-generation antihistamine, is a specific, orally active and long-acting histamine H1-receptor antagonist. Cetirizine marks antiallergic properties and inhibits eosinophil chemotaxis during the allergic response.
Molecular Weight: 417, 76
