Product Overview
CU-CPT22 | T15020 | TargetMol Chemicals
CAS: 1416324-85-0
Smiles: CCCCCCOC(=O)c1cc(O)c(=O)c2c(O)c(O)c(OC)cc2c1
Formula: C19H22O7
Pathway: Immunology/Inflammation
Target: TLR
Receptor: N/A
Bioactivity: CU-CPT22 is the first probe for the complex between toll-like receptors TLR1 and TLR2. CU-CPT22 binds at the interface of TLR1 and TLR2 (IC50 = 0.58 μM). It competes with the synthetic triacylated lipoprotein (Pam3CSK4) binding to TLR1/2 (Ki: 0.41 μM).
Molecular Weight: 362, 378
