Product Overview
Cucurbitacin IIb | T4S1469 | TargetMol Chemicals
CAS: 50298-90-3
Smiles: CC(C)(O)CCC(=O)[C@](C)(O)[C@H]1[C@H](O)C[C@@]2(C)[C@@H]3CC=C4[C@@H](C[C@H](O)[C@@H](O)C4(C)C)[C@]3(C)C(=O)C[C@]12C
Formula: C30H48O7
Pathway: Apoptosis|||Others
Target: Apoptosis|||Others
Receptor: N/A
Bioactivity: 1. Cucurbitacin IIb is one of the major active compounds in Hemsleyadine tablets which have been used for clinical treatment of bacillary dysentery, enteritis and acute tonsilitis. 2. Cucurbitacin IIb exhibits its anti-inflammatory activity through modulating multiple cellular behaviors and signaling pathways, leading to the suppression of the adaptive immune response.
Molecular Weight: 520, 707
