Product Overview
Decursin | T3S1416 | TargetMol Chemicals
CAS: 5928-25-6
Smiles: CC(C)=CC(=O)O[C@H]1Cc2cc3ccc(=O)oc3cc2OC1(C)C
Formula: C19H20O5
Pathway: Apoptosis|||Chromatin/Epigenetic|||Cytoskeletal Signaling
Target: Apoptosis|||PKC
Receptor: N/A
Bioactivity: 1. Decursin is able to attenuate kainic acid-induced seizures and could have potential as an antiepileptic drug. 2. Decursin exhibits hepatoprotective effects, potentially by inhibiting the TGF-β1 induced NOX activation and Smad signaling. 3. Decursin has anti-cancer activity, mediated suppression of the PKCα, MAPK and NF-κB pathways in MCF-7 cells. 4. Decursin exhibits cytotoxicity against various human cancer cells and to possess anti-amnesic activity in vivo through the inhibition of AChE activity.
Molecular Weight: 328, 364
