Product Overview
Dehydrocorydaline nitrate | T2S2362 | TargetMol Chemicals
CAS: 13005-09-9
Smiles: [O-][N+]([O-])=O.COc1ccc2c(C)c3-c4cc(OC)c(OC)cc4CC[n+]3cc2c1OC
Formula: C22H24N2O7
Pathway: Apoptosis|||Autophagy|||Chromatin/Epigenetic|||DNA Damage/DNA Repair|||MAPK|||Microbiology/Virology|||Others|||Proteases/Proteasome
Target: BCL|||Others|||PARP|||p38 MAPK|||Caspase|||Parasite|||Autophagy
Receptor: N/A
Bioactivity: 1. Dehydrocorydaline(DHC) not only inhibits antibody-mediated allergic reactions but also influences cell-mediated allergic reactions, and the inhibitory effect of Corydalis Tuber on allergic reactions may be partially attributed to DHC. 2. Dehydrocorydaline can inhibit elevated mitochondrial membrane potential in lipopolysaccharide-stimulated macrophages. 3. Dehydrocorydaline has antinociceptive effects in mouse models of inflammatory pain, the effects involve the opioid receptor and inflammatory cytokines. 4. Dehydrocorydaline has anti-inflammatory activity.
Molecular Weight: 428, 441
