Product Overview
Ecdysterone 2, 3:20, 22-diacetonide | TN3911 | TargetMol Chemicals
CAS: 22798-98-7
Smiles: CC(C)(O)CC[C@H]1OC(C)(C)O[C@]1(C)C1CC[C@@]2(O)C3=CC(=O)[C@@H]4C[C@@H]5OC(C)(C)O[C@@H]5C[C@]4(C)[C@H]3CC[C@]12C
Formula: C33H52O7
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: Due to the multi-drug resistance reversal activity of the less polar ecdysteroids, several new products( including 20-hydroxyecdysone, 20-hydroxyecdysone 2, 3;20, 22-diacetonide) are promising for being tested against various cancer cell lines.
Molecular Weight: 560, 8
