Product Overview
β-Elemonic Acid | T2S0618 | TargetMol Chemicals
CAS: 28282-25-9
Smiles: CC(C)=CCC[C@@H]([C@@H]1CC[C@]2(C)C3=C(CC[C@@]12C)[C@@]1(C)CCC(=O)C(C)(C)[C@@H]1CC3)C(O)=O
Formula: C30H46O3
Pathway: Apoptosis|||Immunology/Inflammation|||Metabolism|||Neuroscience|||NF-Κb
Target: Apoptosis|||Reactive Oxygen Species|||COX
Receptor: N/A
Bioactivity: 1. Beta-Elemonic acid exhibits anti-inflammatory effects. 2. Beta-Elemonic acid inhibits proliferation by inducing hypoploid cells and cell apoptosis, the anticancer effects of beta-Elemonic acid are related to the MAPK signaling pathway, ROS activation and glutathione depletion in human A549 lung cancer cells. 3. Beta-Elemonic acid exhibits prolyl endopeptidase inhibitory activities.
Molecular Weight: 454, 695
