Product Overview
Emodin-1-O-β-D-glucopyranoside | T2S0389 | TargetMol Chemicals
CAS: 38840-23-2
Smiles: Cc1cc(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c2C(=O)c3c(O)cc(O)cc3C(=O)c2c1
Formula: C21H20O10
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: 1. Emodin 1-O-beta-D-glucoside has neuroprotective and uncoupling activities, and that it may be the a new uncoupler of nNOS-PSD-95. 2. Emodin 1-O-beta-D-glucoside shows inhibitory effects on various tumor cells proliferation.
Molecular Weight: 432, 381
