Product Overview
Flavidin | TN4062 | TargetMol Chemicals
CAS: 83924-98-5
Smiles: Oc1cc2CCc3cc(O)cc4OCc(c1)c2-c34
Formula: C15H12O3
Pathway: GPCR/G Protein|||Immunology/Inflammation|||Neuroscience
Target: COX|||Prostaglandin Receptor
Receptor: N/A
Bioactivity: Flavidin shows very good antioxidant capacity. Flavidin can enhance fluorescent imaging, allowing more sensitive and specific cell labeling in tissues, it should have wide application in molecular detection, providing a general insight into how to optimize simultaneously the behavior of the biomolecule and the chemical probe.
Molecular Weight: 240, 25
