Product Overview
Fumitremorgin B | TN4084 | TargetMol Chemicals
CAS: 12626-17-4
Smiles: COc1ccc2c3[C@H](O)[C@]4(O)N([C@@H](C=C(C)C)c3n(CC=C(C)C)c2c1)C(=O)[C@@H]1CCCN1C4=O
Formula: C27H33N3O5
Pathway: Microbiology/Virology
Target: Antifection
Receptor: N/A
Bioactivity: Fumitremorgen B is a mycotoxin, it exhibits a certain degree of genotoxicity, it can cause DNA damage in human lymphocytes; it shows an inhibitory activity on the cell cycle progression of mouse tsFT210 cells in the M phase, with the MIC value of 26.1 microM. Fumitremorgin B exhibits antifungal activities, it also shows significant toxicity toward brine shrimps, with the median lethal concentration (LC(50)) value of 13.6 ug/mL. Fumitremorgin B possesses antifeedant activity against armyworm larvae.
Molecular Weight: 479, 57
