Product Overview
gamma-Mangostin | T4S1637 | TargetMol Chemicals
CAS: 31271-07-5
Smiles: CC(C)=CCc1c(O)cc2oc3cc(O)c(O)c(CC=C(C)C)c3c(=O)c2c1O
Formula: C23H24O6
Pathway: GPCR/G Protein|||Neuroscience|||Others
Target: Others|||5-HT Receptor
Receptor: N/A
Bioactivity: 1. Gamma-Mangostin as a preventive agent of the metabolic syndrome. 2. Gamma-Mangostin has free radical scavenging activity, and antiproliferative and apoptotic activity in HepG2 cells. 3. Gamma-Mangostin could serve as a micronutrient for colon cancer prevention and is a potential lead compound for the development of anti-colon cancer agents. 4. Gamma-Mangostin may acts as an antihypertensive agent, by causing vasorelaxation which is mediated via the NO-cGMP pathway.
Molecular Weight: 396, 439
