Product Overview
GSK3685032 | T9573 | TargetMol Chemicals
CAS: 2170137-61-6
Smiles: CCc(c(C#N)c(N(CC1)CCC1N)nc1SC(C(N)=O)c2ccccc2)c1C#N
Formula: C22H24N6OS
Pathway: Chromatin/Epigenetic
Target: DNA Methyltransferase
Receptor: N/A
Bioactivity: GSK3685032 is a non-covalent and selective DNMT1 inhibitor(IC50 = 36 nM). The inhibitory effect is time-independent and reversible. GSK3685032 induces loss of DNA methylation and transcriptional activation and inhibits cancer cell growth.
Molecular Weight: 420, 53