Product Overview
Guajadial B | TN4172 | TargetMol Chemicals
CAS: 1414455-03-0
Smiles: C\C1=C/CC(C)(C)\C=C\C[C@@]2(C)Oc3c(C=O)c(O)c(C=O)c(O)c3[C@H]([C@@H]2CC1)c1ccccc1
Formula: C30H34O5
Pathway: DNA Damage/DNA Repair
Target: Topoisomerase
Receptor: N/A
Bioactivity: Guajadial B acts as a Top1 catalytic inhibitor and delays Top1 poison-mediated DNA damage. Guajadial B shows cytotoxicities against five human cancer cell lines, it is the most effective having an IC50 value of 150 nM toward A549 cells.
Molecular Weight: 474, 6
