Product Overview
HATU | T21354 | TargetMol Chemicals
CAS: 148893-10-1
Smiles: F[P-](F)(F)(F)(F)F.CN(C)C(On1nnc2cccnc12)=[N+](C)C
Formula: C10H15F6N6OP
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: HATU is a reagent used in peptide coupling chemistry to generate an active ester from a carboxylic acid. HATU is used along with Hünig's base (N, N-diisopropylethylamine, DIPEA) to form amide bonds.
Molecular Weight: 380, 235