Product Overview
Insulin B (20-30) | T24168 | TargetMol Chemicals
CAS: 91921-56-1
Smiles: C[C@@H](O)[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1ccccc1)NC(=O)CNC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CCC(O)=O)NC(=O)CN)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C)C(O)=O
Formula: C60H85N15O16
Pathway: N/A
Target: N/A
Receptor: N/A
Bioactivity: Insulin B (20-30) is a peptide hormone produced by beta cells of the pancreatic islets, and it is considered to be the main anabolic hormone of the body. It is therefore an anabolic hormone, promoting the conversion of small molecules in the blood into large molecules inside the cells.
Molecular Weight: 1272, 429
