Product Overview
Insulin B (22-30) | T24169 | TargetMol Chemicals
CAS: 89270-99-5
Smiles: C[C@@H](O)[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1ccccc1)NC(=O)CNC(=O)[C@@H](N)CCCNC(N)=N)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C)C(O)=O
Formula: C53H75N13O12
Pathway: N/A
Target: N/A
Receptor: N/A
Bioactivity: Insulin B (22-30) is a peptide hormone produced by beta cells of the pancreatic islets, and it is considered to be the main anabolic hormone of the body. It is therefore an anabolic hormone, promoting the conversion of small molecules in the blood into large molecules inside the cells.
Molecular Weight: 1086, 262
