Product Overview
iRucaparib-AP6 | T13737 | TargetMol Chemicals
CAS: 2410557-00-3
Smiles: CN(CCOCCOCCOCCOCCOCCOCCNc1cccc2C(=O)N(C3CCC(=O)NC3=O)C(=O)c12)Cc1ccc(cc1)-c1[nH]c2cc(F)cc3C(=O)NCCc1c23
Formula: C46H55FN6O11
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: iRucaparib-AP6, a non-trapping PARP1 degrader, blocks both the catalytic activity and scaffolding effects of PARP1. iRucaparib-AP6 is a highly efficient and specific PARP1 degrader based on Rucaparib by using the PROTAC approach.
Molecular Weight: 886, 975
