Product Overview
Kirenol | T4S1943 | TargetMol Chemicals
CAS: 52659-56-0
Smiles: C[C@@]1(CO)C[C@@H](O)C[C@@]2(C)[C@@H]3CC[C@@](C)(C=C3CC[C@H]12)[C@@H](O)CO
Formula: C20H34O4
Pathway: Cytoskeletal Signaling|||Stem Cells
Target: Wnt/beta-catenin
Receptor: N/A
Bioactivity: 1. Kirenol has anti-oxidant, anti-inflammatory, anti-allergic, and anti-arthritic activities. 2. Kirenol is effective against gram-positive bacteria. 3. Kirenol possesses antitumor action on human chronic myeloid leukemia K562 cells in vitro. 4. Kirenol is capable of promoting osteoblast differentiation in MC3T3-E1 cells through activation of the BMP and Wnt/β-catenin signaling pathways. 5. Kirenol treatment reduces pro-inflammatory cytokine secretion, increases anti-inflammatory cytokine production, inhibits cell proliferation and induces apoptosis of CII-specific lymphocytes in vitro.
Molecular Weight: 338, 488