Product Overview
Liothyronine sodium | T1669 | TargetMol Chemicals
CAS: 55-06-1
Smiles: [Na+].NC(Cc1cc(I)c(Oc2ccc(O)c(I)c2)c(I)c1)C([O-])=O
Formula: C15H11I3NNaO4
Pathway: Endocrinology/Hormones
Target: Thyroid hormone receptor(THR)
Receptor: N/A
Bioactivity: Liothyronine Sodium is the sodium salt form of liothyronine, a synthetic form of the levorotatory isomer of the naturally occurring thyroid hormone triiodothyronine (T3). Liothyronine sodium binds to nuclear thyroid receptors which then bind to thyroid hormone response elements of target genes. As a result, liothyronine sodium induces gene expression that is required for normal growth and development. Liothyronine sodium is more potent and has a more rapid action than thyroxine (T4).
Molecular Weight: 672, 959
