Product Overview
MALAT1-IN-1 | T16007 | TargetMol Chemicals
CAS: 827327-28-6
Smiles: COc1ccc(cc1)-c1cnc(NCc2cccc(OC)c2)n1C
Formula: C19H21N3O2
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: MALAT1-IN-1 modulated Malat1 downstream genes in a dose-dependent manner without affecting the expression of nuclear enriched abundant transcript 1 (Neat1). MALAT1-IN-1 is an effective and specific Malat1 inhibitor.
Molecular Weight: 323, 396