N-(1-benzyl-4-piperidyl)adamantane-1-carboxamide | T8502

N-(1-benzyl-4-piperidyl)adamantane-1-carboxamide | T8502 | TargetMol Chemicals

CAS: 314030-54-1

Smiles: O=C(NC1CCN(Cc2ccccc2)CC1)C12CC3CC(CC(C3)C1)C2

Formula: C23H32N2O

Pathway: Microbiology/Virology

Target: Influenza Virus

Receptor: N/A

Bioactivity: N-(1-benzyl-4-piperidyl)adamantane-1-carboxamide inhibiting the entry of Ebola virus in host cells by binding to the surface glycoprotein, the compound inhibited the Ebola virus with EC50 of 3.9 μM.

Molecular Weight: 352, 522