Neurokinin B acetate(86933-75-7 free base) | TP1363L

Neurokinin B acetate(86933-75-7 free base) | TP1363L | TargetMol Chemicals

CAS: TP1363L

Smiles: CC(O)=O.O=C(N[C@@H](CCSC)C(N[C@@H](CC1=CNC=N1)C(N[C@@H](CC(O)=O)C(N[C@@H](CC2=CC=CC=C2)C(N[C@@H](CC3=CC=CC=C3)C(N[C@@H](C(C)C)C(NCC(N[C@@H](CC(C)C)C(N[C@@H](CCSC)C(N)=O)=O)=O)=O)=O)=O)=O)=O)=O)[C@H](CC(O)=O)N

Formula: C57H83N13O16S2

Pathway: GPCR/G Protein|||Neuroscience

Target: Neurokinin receptor

Receptor: N/A

Bioactivity: Neurokinin B acetate is the acetate form of Neurokinin B, which belongs to the tachykinin family. Neurokinin binds to neurokinin receptor 1 (NK1R), nk2r and NK3R, and mediates its biological effects.

Molecular Weight: 1270, 48