Product Overview
Nitracrine | T16327 | TargetMol Chemicals
CAS: 4533-39-5
Smiles: CN(C)CCCNc1c2ccccc2nc2cccc([N+]([O-])=O)c12
Formula: C18H20N4O2
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: Nitracrine is a 1-nitroacridine derivative and is an effective hypoxia-selective agent in vitro and antitumor drugs. Nitracrine suppresses RNA synthesis and covalently, reversibly binds to DNA but also forms covalent adducts with DNA in vivo. Nitracrine has cytotoxicity towards most cells.
Molecular Weight: 324, 384