Product Overview
Oroxylin A | T6S1315 | TargetMol Chemicals
CAS: 480-11-5
Smiles: COc1c(O)cc2oc(cc(=O)c2c1O)-c1ccccc1
Formula: C16H12O5
Pathway: Autophagy|||Chromatin/Epigenetic|||Metabolism|||Microbiology/Virology
Target: Virus Protease|||HIF/HIF Prolyl-Hydroxylase|||Autophagy
Receptor: N/A
Bioactivity: 1. Oroxylin A has various anti-tumor effects including apoptosis, cell cycle arrest, drug-resistant reversion. 2. Oroxylin A possesses abilities of inhibiting the ATRA-induced IL-6 production via modulation of LAP/LIP/CHOP in leukemia cell lines, which could providing a therapeutic strategy for RAS. 3. Oroxylin A inhibits UCP2s triggers the MPTP opening, and promotes the apoptosis in CaCo-2 cells; uncoupling protein 2 plays a key role in mitochondrial apoptotic pathway. 4. Oroxylin A inhibits N1ICD translocating to the nucleus and binding to epithelial-mesenchymal transition-related transcription factor Snail, thus suppressing the invasion and migration of MCF-7 cells. 5. Oroxylin A improves the sensitivity of K562/ADM cells by increasing apoptosis in leukemic cells and decreasing the expression of CXCR4 and PI3K/Akt/NF-κB pathway, and probably served as a most promising agent for CML treatment.
Molecular Weight: 284, 267
