Product Overview
Polymyxin B nonapeptide acetate | TP1341L | TargetMol Chemicals
CAS: TP1341L
Smiles: C[C@@H](O)[C@H]1C(NCC[C@H](NC([C@@H](NC([C@@H](N)[C@H](O)C)=O)CCN)=O)C(N[C@@H](CCN)C(N[C@H](CC2=CC=CC=C2)C(N[C@@H](CC(C)C)C(N[C@@H](CCN)C(N[C@@H](CCN)C(N1)=O)=O)=O)=O)=O)=O)=O.CC(O)=O
Formula: C45H78N14O13
Pathway: Microbiology/Virology
Target: Antibacterial|||Antibiotic
Receptor: N/A
Bioactivity: Polymyxin B nonapeptide acetate is a cationic cyclic peptide. Polyxin B nonapeptide is a derivative produced by enzymatic cleavage of polyxin B. Compared with polyxin B, polyxin B nonapeptide has low toxicity, lacks bactericidal activity and still has the ability to destroy the outer membrane of Gram-negative bacteria.
Molecular Weight: 1023, 19
