Product Overview
Ro 46-2005 | T3194 | TargetMol Chemicals
CAS: 150725-87-4
Smiles: COc1cccc(Oc2c(NS(=O)(=O)c3ccc(cc3)C(C)(C)C)ncnc2OCCO)c1
Formula: C23H27N3O6S
Pathway: GPCR/G Protein
Target: Endothelin Receptor
Receptor: N/A
Bioactivity: Ro 46-2005 is a synthetic non-peptide endothelin receptor antagonist, inhibits the specific binding of 125I-ET-1 to human vascular smooth muscle cells (ETA receptor, IC50: 220 nM).
Molecular Weight: 473, 54
