[Sar9, Met(O2)11]-Substance P acetate | TP1369L

[Sar9, Met(O2)11]-Substance P acetate | TP1369L | TargetMol Chemicals

CAS: TP1369L

Smiles: O=C([C@H](CCCCN)NC([C@H]1N(C([C@@H](N)CCCNC(N)=N)=O)CCC1)=O)N(CCC2)[C@@H]2C(N[C@@H](CCC(N)=O)C(N[C@@H](CCC(N)=O)C(N[C@H](C(N[C@H](C(N(C)CC(N[C@@H](CC(C)C)C(N[C@H](C(N)=O)CCS(C)(=O)=O)=O)=O)=O)CC3=CC=CC=C3)=O)CC4=CC=CC=C4)=O)=O)=O.CC(O)=C.[O]

Formula: C67H106N18O17S

Pathway: GPCR/G Protein|||Neuroscience

Target: Neurokinin receptor

Receptor: N/A

Bioactivity: [Sar9, Met(O2)11]-Substance P acetate is a tachykinin NK1 receptor selective agonist. [Sar9, Met(O2)11]-Substance P acetate is a selective tachykinin NK1 receptor agonist.[Sar9, Met(O2)11]-Substance P acetate and septide (10-100 pmol per rat, i.c.v.) are equipotent in increasing mean arterial blood pressure (MAP) and heart rate (HR), yet they have dissimilar time-course. Both agonists increase dose-dependently face washing and sniffing while [Sar9, Met(O2)11]-Substance P acetate is the sole to produce grooming.

Molecular Weight: 1467, 75