Product Overview
Scutebarbatine X | TN2194 | TargetMol Chemicals
CAS: 1312716-26-9
Smiles: CC(=O)O[C@@H](CC1=C(O)C(=O)OC1)[C@]1(C)[C@H]2CCC=C(C)[C@]2(C)[C@@H](OC(=O)c2cccnc2)[C@H](OC(=O)c2cccnc2)[C@]1(C)O
Formula: C34H38N2O10
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: Scutebarbatine X can inhibit nitric oxide production efficiently with IC50 values of lower than 50 μM, it may have potential effects on the reduction of neuroinflammation.
Molecular Weight: 634, 682
