Product Overview
SNS-314 | T21298 | TargetMol Chemicals
CAS: 1057249-41-8
Smiles: Clc1cccc(NC(=O)Nc2ncc(CCNc3ncnc4ccsc34)s2)c1
Formula: C18H15ClN6OS2
Pathway: N/A
Target: N/A
Receptor: N/A
Bioactivity: SNS-314, a synthetic small molecule Aurora kinase (AK) inhibitor with potential antineoplastic activity, selectively binds and inhibits AKs A and B, resulting in the inhibition of cell division and proliferation in tumor cells that overexpress AKs.
Molecular Weight: 430, 93
