Product Overview
Sofosbuvir impurity B | T12957 | TargetMol Chemicals
CAS: T12957
Smiles: O=[P@@](N[C@@H](C)C(OC(C)C)=O)(OC[C@@H]1[C@@H](O)[C@](F)(C)[C@@H](N2C=CC(NC2=O)=O)O1)OC3=CC=CC=C3
Formula: C22H29FN3O9P
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: Sofosbuvir impurity B is the less active impurity of Sofosbuvir. Sofosbuvir is an active HCV RNA replication inhibitor in the HCV replicon assay, with potent anti-hepatitis C virus (HCV) activity.
Molecular Weight: 529, 45
