Product Overview
Thalidomide-O-amido-C8-NH2 | T17819 | TargetMol Chemicals
CAS: 1950635-15-0
Smiles: NCCCCCCCCNC(=O)COc1cccc2C(=O)N(C3CCC(=O)NC3=O)C(=O)c12
Formula: C23H30N4O6
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: Thalidomide-O-amido-C8-NH2 (Cereblon Ligand-Linker Conjugates 2), a synthesized E3 ligase ligand-linker conjugate that incorporates the Thalidomide based cereblon ligand and a linker, can be used in the synthesis of PROTACs[1].
Molecular Weight: 458, 515
