Product Overview
Tirotundin | TN5149 | TargetMol Chemicals
CAS: 56377-67-4
Smiles: CC(C)C(=O)O[C@@H]1C[C@]2(C)CC[C@@](O)(O2)[C@@H](C)C[C@H]2OC(=O)C(=C)[C@H]12
Formula: C19H28O6
Pathway: DNA Damage/DNA Repair|||Immunology/Inflammation|||Metabolism|||Neuroscience|||NF-Κb
Target: NF-κB|||COX|||PPAR
Receptor: N/A
Bioactivity: Tirotundin is a PPARα/γ dual agonist, it exerts anti-diabetic effect through PPARγ pathway. It shows anti-inflammatory activity, it inhibits inhibit the activation of NF-kappa B, thereby, the synthesis of inflammatory mediators such as cytokines and chemokines is reduced.
Molecular Weight: 352, 4
