Product Overview
δ-Tocotrienol | TMA2474 | TargetMol Chemicals
CAS: 25612-59-3
Smiles: CC(C)=CCC\C(C)=C\CC\C(C)=C\CC[C@]1(C)CCc2cc(O)cc(C)c2O1
Formula: C27H40O2
Pathway: Angiogenesis|||Apoptosis|||Cytoskeletal Signaling|||MAPK|||PI3K/Akt/mTOR signaling|||Tyrosine Kinase/Adaptors
Target: ERK|||BCL|||VEGFR|||Akt|||PI3K|||PDK|||p53
Receptor: N/A
Bioactivity: δ-Tocotrienol is a potential angiogenic inhibitor. δ-Tocotrienol is also a nontoxic activator of mir-34a which can inhibit nonsmall cell lung cancer cells (NSCLC) cell proliferation, induce apoptosis and inhibit invasion, and thus offering a potential starting point for the design of novel anticancer agents.
Molecular Weight: 396, 61
