Product Overview
Tubastatin A | T1966 | TargetMol Chemicals
CAS: 1252003-15-8
Smiles: CN1CCc2c(C1)c1ccccc1n2Cc1ccc(cc1)C(=O)NO
Formula: C20H21N3O2
Pathway: Apoptosis|||Autophagy|||Chromatin/Epigenetic|||DNA Damage/DNA Repair
Target: Apoptosis|||HDAC|||Autophagy
Receptor: N/A
Bioactivity: Tubastatin A is an effective and specific HDAC6 inhibitor (IC50: 15 nM, in a cell-free assay). Its selectivity is 1000-fold against all the other isozymes except HDAC8.
Molecular Weight: 335, 407
